C32H36N4O4S — CID 59634878
N-[4-[4-[(4-pentoxyphenyl)methyl]piperazine-1-carbonyl]phenyl]quinoline-8-sulfonamide (PubChem CID 59634878) has the molecular formula C32H36N4O4S and a molecular weight of 572.73 g/mol. Its IUPAC name is N-[4-[4-[(4-pentoxyphenyl)methyl]piperazine-1-carbonyl]phenyl]quinoline-8-sulfonamide.
| Compound Name | N-[4-[4-[(4-pentoxyphenyl)methyl]piperazine-1-carbonyl]phenyl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 59634878 |
| Molecular Formula | C32H36N4O4S |
| Molecular Weight | 572.73 g/mol |
| Exact Mass | 572.25 |
| IUPAC Name | N-[4-[4-[(4-pentoxyphenyl)methyl]piperazine-1-carbonyl]phenyl]quinoline-8-sulfonamide |
| SMILES | CCCCCOc1ccc(CN2CCN(C(=O)c3ccc(NS(=O)(=O)c4cccc5cccnc45)cc3)CC2)cc1 |
| InChI | InChI=1S/C32H36N4O4S/c1-2-3-4-23-40-29-16-10-25(11-17-29)24-35-19-21-36(22-20-35)32(37)27-12-14-28(15-13-27)34-41(38,39)30-9-5-7-26-8-6-18-33-31(26)30/h5-18,34H,2-4,19-24H2,1H3 |
| InChIKey | JKAWHRPOMNXWJE-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.73 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|