C29H31N5O3S — CID 59635159
N-[4-[4-[[4-(dimethylamino)phenyl]methyl]piperazine-1-carbonyl]phenyl]quinoline-8-sulfonamide (PubChem CID 59635159) has the molecular formula C29H31N5O3S and a molecular weight of 529.67 g/mol. Its IUPAC name is N-[4-[4-[[4-(dimethylamino)phenyl]methyl]piperazine-1-carbonyl]phenyl]quinoline-8-sulfonamide.
| Compound Name | N-[4-[4-[[4-(dimethylamino)phenyl]methyl]piperazine-1-carbonyl]phenyl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 59635159 |
| Molecular Formula | C29H31N5O3S |
| Molecular Weight | 529.67 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | N-[4-[4-[[4-(dimethylamino)phenyl]methyl]piperazine-1-carbonyl]phenyl]quinoline-8-sulfonamide |
| SMILES | CN(C)c1ccc(CN2CCN(C(=O)c3ccc(NS(=O)(=O)c4cccc5cccnc45)cc3)CC2)cc1 |
| InChI | InChI=1S/C29H31N5O3S/c1-32(2)26-14-8-22(9-15-26)21-33-17-19-34(20-18-33)29(35)24-10-12-25(13-11-24)31-38(36,37)27-7-3-5-23-6-4-16-30-28(23)27/h3-16,31H,17-21H2,1-2H3 |
| InChIKey | BORSKRGOCDNYHO-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 85.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.67 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|