C21H20N4O3S — CID 20972280
3-[(4-quinolin-8-ylsulfonylpiperazin-1-yl)methyl]-1,2-benzoxazole (PubChem CID 20972280) has the molecular formula C21H20N4O3S and a molecular weight of 408.48 g/mol. Its IUPAC name is 3-[(4-quinolin-8-ylsulfonylpiperazin-1-yl)methyl]-1,2-benzoxazole.
| Compound Name | 3-[(4-quinolin-8-ylsulfonylpiperazin-1-yl)methyl]-1,2-benzoxazole |
|---|---|
| PubChem CID | 20972280 |
| Molecular Formula | C21H20N4O3S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 3-[(4-quinolin-8-ylsulfonylpiperazin-1-yl)methyl]-1,2-benzoxazole |
| SMILES | O=S(=O)(c1cccc2cccnc12)N1CCN(Cc2noc3ccccc23)CC1 |
| InChI | InChI=1S/C21H20N4O3S/c26-29(27,20-9-3-5-16-6-4-10-22-21(16)20)25-13-11-24(12-14-25)15-18-17-7-1-2-8-19(17)28-23-18/h1-10H,11-15H2 |
| InChIKey | AOUXKBBNZPHMTR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 79.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |