C27H22N4O4S — CID 22629324
(4E)-2-naphthalen-1-yl-4-[(4-quinolin-8-ylsulfonylpiperazin-1-yl)methylidene]-1,3-oxazol-5-one (PubChem CID 22629324) has the molecular formula C27H22N4O4S and a molecular weight of 498.56 g/mol. Its IUPAC name is (4E)-2-naphthalen-1-yl-4-[(4-quinolin-8-ylsulfonylpiperazin-1-yl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4E)-2-naphthalen-1-yl-4-[(4-quinolin-8-ylsulfonylpiperazin-1-yl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 22629324 |
| Molecular Formula | C27H22N4O4S |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | (4E)-2-naphthalen-1-yl-4-[(4-quinolin-8-ylsulfonylpiperazin-1-yl)methylidene]-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2cccc3ccccc23)=N/C1=C/N1CCN(S(=O)(=O)c2cccc3cccnc23)CC1 |
| InChI | InChI=1S/C27H22N4O4S/c32-27-23(29-26(35-27)22-11-3-7-19-6-1-2-10-21(19)22)18-30-14-16-31(17-15-30)36(33,34)24-12-4-8-20-9-5-13-28-25(20)24/h1-13,18H,14-17H2/b23-18+ |
| InChIKey | JYNIIFSNXOUHJV-PTGBLXJZSA-N |
| XLogP | 3.54 |
| TPSA | 92.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|