C25H22ClN5O2 — CID 54070928
N'-(2-chlorophenyl)-4-[(2-naphthalen-1-yl-5-oxo-1,3-oxazol-4-ylidene)methyl]piperazine-1-carboximidamide (PubChem CID 54070928) has the molecular formula C25H22ClN5O2 and a molecular weight of 459.94 g/mol. Its IUPAC name is N'-(2-chlorophenyl)-4-[(2-naphthalen-1-yl-5-oxo-1,3-oxazol-4-ylidene)methyl]piperazine-1-carboximidamide.
| Compound Name | N'-(2-chlorophenyl)-4-[(2-naphthalen-1-yl-5-oxo-1,3-oxazol-4-ylidene)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 54070928 |
| Molecular Formula | C25H22ClN5O2 |
| Molecular Weight | 459.94 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | N'-(2-chlorophenyl)-4-[(2-naphthalen-1-yl-5-oxo-1,3-oxazol-4-ylidene)methyl]piperazine-1-carboximidamide |
| SMILES | N/C(=N\c1ccccc1Cl)N1CCN(C=C2N=C(c3cccc4ccccc34)OC2=O)CC1 |
| InChI | InChI=1S/C25H22ClN5O2/c26-20-10-3-4-11-21(20)29-25(27)31-14-12-30(13-15-31)16-22-24(32)33-23(28-22)19-9-5-7-17-6-1-2-8-18(17)19/h1-11,16H,12-15H2,(H2,27,29) |
| InChIKey | MGJNTHCSNSSQRC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 83.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.94 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|