C24H21N3O3S — CID 54128564
2-naphthalen-1-yl-4-[[4-(2-thiophen-2-ylacetyl)piperazin-1-yl]methylidene]-1,3-oxazol-5-one (PubChem CID 54128564) has the molecular formula C24H21N3O3S and a molecular weight of 431.52 g/mol. Its IUPAC name is 2-naphthalen-1-yl-4-[[4-(2-thiophen-2-ylacetyl)piperazin-1-yl]methylidene]-1,3-oxazol-5-one.
| Compound Name | 2-naphthalen-1-yl-4-[[4-(2-thiophen-2-ylacetyl)piperazin-1-yl]methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 54128564 |
| Molecular Formula | C24H21N3O3S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 2-naphthalen-1-yl-4-[[4-(2-thiophen-2-ylacetyl)piperazin-1-yl]methylidene]-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2cccc3ccccc23)=NC1=CN1CCN(C(=O)Cc2cccs2)CC1 |
| InChI | InChI=1S/C24H21N3O3S/c28-22(15-18-7-4-14-31-18)27-12-10-26(11-13-27)16-21-24(29)30-23(25-21)20-9-3-6-17-5-1-2-8-19(17)20/h1-9,14,16H,10-13,15H2 |
| InChIKey | NSRJDFQDBIUALU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 62.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|