C32H29N5O3 — CID 22629278
4-[(E)-(2-naphthalen-1-yl-5-oxo-1,3-oxazol-4-ylidene)methyl]-N'-(4-phenylmethoxyphenyl)piperazine-1-carboximidamide (PubChem CID 22629278) has the molecular formula C32H29N5O3 and a molecular weight of 531.62 g/mol. Its IUPAC name is 4-[(E)-(2-naphthalen-1-yl-5-oxo-1,3-oxazol-4-ylidene)methyl]-N'-(4-phenylmethoxyphenyl)piperazine-1-carboximidamide.
| Compound Name | 4-[(E)-(2-naphthalen-1-yl-5-oxo-1,3-oxazol-4-ylidene)methyl]-N'-(4-phenylmethoxyphenyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 22629278 |
| Molecular Formula | C32H29N5O3 |
| Molecular Weight | 531.62 g/mol |
| Exact Mass | 531.23 |
| IUPAC Name | 4-[(E)-(2-naphthalen-1-yl-5-oxo-1,3-oxazol-4-ylidene)methyl]-N'-(4-phenylmethoxyphenyl)piperazine-1-carboximidamide |
| SMILES | N/C(=N\c1ccc(OCc2ccccc2)cc1)N1CCN(/C=C2/N=C(c3cccc4ccccc34)OC2=O)CC1 |
| InChI | InChI=1S/C32H29N5O3/c33-32(34-25-13-15-26(16-14-25)39-22-23-7-2-1-3-8-23)37-19-17-36(18-20-37)21-29-31(38)40-30(35-29)28-12-6-10-24-9-4-5-11-27(24)28/h1-16,21H,17-20,22H2,(H2,33,34)/b29-21+ |
| InChIKey | INXCVZURQMHHAX-XHLNEMQHSA-N |
| XLogP | 4.83 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.62 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|