C27H24N4O4 — CID 70155605
N-[[1-[(2-naphthalen-1-yl-5-oxo-1,3-oxazol-4-ylidene)methyl]piperidin-4-yl]carbamoyl]benzamide (PubChem CID 70155605) has the molecular formula C27H24N4O4 and a molecular weight of 468.51 g/mol. Its IUPAC name is N-[[1-[(2-naphthalen-1-yl-5-oxo-1,3-oxazol-4-ylidene)methyl]piperidin-4-yl]carbamoyl]benzamide.
| Compound Name | N-[[1-[(2-naphthalen-1-yl-5-oxo-1,3-oxazol-4-ylidene)methyl]piperidin-4-yl]carbamoyl]benzamide |
|---|---|
| PubChem CID | 70155605 |
| Molecular Formula | C27H24N4O4 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | N-[[1-[(2-naphthalen-1-yl-5-oxo-1,3-oxazol-4-ylidene)methyl]piperidin-4-yl]carbamoyl]benzamide |
| SMILES | O=C(NC(=O)c1ccccc1)NC1CCN(C=C2N=C(c3cccc4ccccc34)OC2=O)CC1 |
| InChI | InChI=1S/C27H24N4O4/c32-24(19-8-2-1-3-9-19)30-27(34)28-20-13-15-31(16-14-20)17-23-26(33)35-25(29-23)22-12-6-10-18-7-4-5-11-21(18)22/h1-12,17,20H,13-16H2,(H2,28,30,32,34) |
| InChIKey | ZQFYFTBMURWIAU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|