C27H25N3O4 — CID 70157423
4-[[4-(furan-2-carbonyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]methylidene]-2-naphthalen-1-yl-1,3-oxazol-5-one (PubChem CID 70157423) has the molecular formula C27H25N3O4 and a molecular weight of 455.51 g/mol. Its IUPAC name is 4-[[4-(furan-2-carbonyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]methylidene]-2-naphthalen-1-yl-1,3-oxazol-5-one.
| Compound Name | 4-[[4-(furan-2-carbonyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]methylidene]-2-naphthalen-1-yl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 70157423 |
| Molecular Formula | C27H25N3O4 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | 4-[[4-(furan-2-carbonyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]methylidene]-2-naphthalen-1-yl-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2cccc3ccccc23)=NC1=CN1CCN(C(=O)c2ccco2)C2CCCCC21 |
| InChI | InChI=1S/C27H25N3O4/c31-26(24-13-6-16-33-24)30-15-14-29(22-11-3-4-12-23(22)30)17-21-27(32)34-25(28-21)20-10-5-8-18-7-1-2-9-19(18)20/h1-2,5-10,13,16-17,22-23H,3-4,11-12,14-15H2 |
| InChIKey | BJICAFIXUDTIGU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 75.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|