C19H20ClN5O2 — CID 70159076
4-[(2-naphthalen-1-yl-5-oxo-1,3-oxazol-4-ylidene)methyl]piperazine-1-carboximidamide;hydrochloride (PubChem CID 70159076) has the molecular formula C19H20ClN5O2 and a molecular weight of 385.86 g/mol. Its IUPAC name is 4-[(2-naphthalen-1-yl-5-oxo-1,3-oxazol-4-ylidene)methyl]piperazine-1-carboximidamide;hydrochloride.
| Compound Name | 4-[(2-naphthalen-1-yl-5-oxo-1,3-oxazol-4-ylidene)methyl]piperazine-1-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 70159076 |
| Molecular Formula | C19H20ClN5O2 |
| Molecular Weight | 385.86 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 4-[(2-naphthalen-1-yl-5-oxo-1,3-oxazol-4-ylidene)methyl]piperazine-1-carboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)N1CCN(C=C2N=C(c3cccc4ccccc34)OC2=O)CC1 |
| InChI | InChI=1S/C19H19N5O2.ClH/c20-19(21)24-10-8-23(9-11-24)12-16-18(25)26-17(22-16)15-7-3-5-13-4-1-2-6-14(13)15;/h1-7,12H,8-11H2,(H3,20,21);1H |
| InChIKey | OYVJQXXLONGUFZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 95.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.86 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|