C31H34ClN5O2 — CID 22629476
N'-(4-cyclohexylphenyl)-4-[(E)-(2-naphthalen-1-yl-5-oxo-1,3-oxazol-4-ylidene)methyl]piperazine-1-carboximidamide;hydrochloride (PubChem CID 22629476) has the molecular formula C31H34ClN5O2 and a molecular weight of 544.10 g/mol. Its IUPAC name is N'-(4-cyclohexylphenyl)-4-[(E)-(2-naphthalen-1-yl-5-oxo-1,3-oxazol-4-ylidene)methyl]piperazine-1-carboximidamide;hydrochloride.
| Compound Name | N'-(4-cyclohexylphenyl)-4-[(E)-(2-naphthalen-1-yl-5-oxo-1,3-oxazol-4-ylidene)methyl]piperazine-1-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 22629476 |
| Molecular Formula | C31H34ClN5O2 |
| Molecular Weight | 544.10 g/mol |
| Exact Mass | 543.24 |
| IUPAC Name | N'-(4-cyclohexylphenyl)-4-[(E)-(2-naphthalen-1-yl-5-oxo-1,3-oxazol-4-ylidene)methyl]piperazine-1-carboximidamide;hydrochloride |
| SMILES | Cl.N/C(=N\c1ccc(C2CCCCC2)cc1)N1CCN(/C=C2/N=C(c3cccc4ccccc34)OC2=O)CC1 |
| InChI | InChI=1S/C31H33N5O2.ClH/c32-31(33-25-15-13-23(14-16-25)22-7-2-1-3-8-22)36-19-17-35(18-20-36)21-28-30(37)38-29(34-28)27-12-6-10-24-9-4-5-11-26(24)27;/h4-6,9-16,21-22H,1-3,7-8,17-20H2,(H2,32,33);1H/b28-21+; |
| InChIKey | NGXKVGORCYXEKC-HUPDFLJJSA-N |
| XLogP | 5.72 |
| TPSA | 83.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.10 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|