C21H20N4O3 — CID 22629529
(4E)-4-[[4-(4,5-dihydro-1,3-oxazol-2-yl)piperazin-1-yl]methylidene]-2-naphthalen-1-yl-1,3-oxazol-5-one (PubChem CID 22629529) has the molecular formula C21H20N4O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is (4E)-4-[[4-(4,5-dihydro-1,3-oxazol-2-yl)piperazin-1-yl]methylidene]-2-naphthalen-1-yl-1,3-oxazol-5-one.
| Compound Name | (4E)-4-[[4-(4,5-dihydro-1,3-oxazol-2-yl)piperazin-1-yl]methylidene]-2-naphthalen-1-yl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 22629529 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | (4E)-4-[[4-(4,5-dihydro-1,3-oxazol-2-yl)piperazin-1-yl]methylidene]-2-naphthalen-1-yl-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2cccc3ccccc23)=N/C1=C/N1CCN(C2=NCCO2)CC1 |
| InChI | InChI=1S/C21H20N4O3/c26-20-18(14-24-9-11-25(12-10-24)21-22-8-13-27-21)23-19(28-20)17-7-3-5-15-4-1-2-6-16(15)17/h1-7,14H,8-13H2/b18-14+ |
| InChIKey | WTLUNMACIAEWQU-NBVRZTHBSA-N |
| XLogP | 1.99 |
| TPSA | 66.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|