C22H23N3O4S — CID 108536450
2-[4-oxo-4-[4-(2-thiophen-2-ylacetyl)piperazin-1-yl]butyl]isoindole-1,3-dione (PubChem CID 108536450) has the molecular formula C22H23N3O4S and a molecular weight of 425.51 g/mol. Its IUPAC name is 2-[4-oxo-4-[4-(2-thiophen-2-ylacetyl)piperazin-1-yl]butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-oxo-4-[4-(2-thiophen-2-ylacetyl)piperazin-1-yl]butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 108536450 |
| Molecular Formula | C22H23N3O4S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 2-[4-oxo-4-[4-(2-thiophen-2-ylacetyl)piperazin-1-yl]butyl]isoindole-1,3-dione |
| SMILES | O=C(CCCN1C(=O)c2ccccc2C1=O)N1CCN(C(=O)Cc2cccs2)CC1 |
| InChI | InChI=1S/C22H23N3O4S/c26-19(8-3-9-25-21(28)17-6-1-2-7-18(17)22(25)29)23-10-12-24(13-11-23)20(27)15-16-5-4-14-30-16/h1-2,4-7,14H,3,8-13,15H2 |
| InChIKey | XXOHXCSESPDARU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|