C17H21N3O5S — CID 108569620
2-[4-(4-methylsulfonylpiperazin-1-yl)-4-oxobutyl]isoindole-1,3-dione (PubChem CID 108569620) has the molecular formula C17H21N3O5S and a molecular weight of 379.44 g/mol. Its IUPAC name is 2-[4-(4-methylsulfonylpiperazin-1-yl)-4-oxobutyl]isoindole-1,3-dione.
| Compound Name | 2-[4-(4-methylsulfonylpiperazin-1-yl)-4-oxobutyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 108569620 |
| Molecular Formula | C17H21N3O5S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 2-[4-(4-methylsulfonylpiperazin-1-yl)-4-oxobutyl]isoindole-1,3-dione |
| SMILES | CS(=O)(=O)N1CCN(C(=O)CCCN2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C17H21N3O5S/c1-26(24,25)19-11-9-18(10-12-19)15(21)7-4-8-20-16(22)13-5-2-3-6-14(13)17(20)23/h2-3,5-6H,4,7-12H2,1H3 |
| InChIKey | HGPAJRUBOSDYJT-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 95.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|