C22H20N4O3S — CID 90560503
1-(1-quinolin-8-ylsulfonylpiperidin-4-yl)oxyphthalazine (PubChem CID 90560503) has the molecular formula C22H20N4O3S and a molecular weight of 420.49 g/mol. Its IUPAC name is 1-(1-quinolin-8-ylsulfonylpiperidin-4-yl)oxyphthalazine.
| Compound Name | 1-(1-quinolin-8-ylsulfonylpiperidin-4-yl)oxyphthalazine |
|---|---|
| PubChem CID | 90560503 |
| Molecular Formula | C22H20N4O3S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 1-(1-quinolin-8-ylsulfonylpiperidin-4-yl)oxyphthalazine |
| SMILES | O=S(=O)(c1cccc2cccnc12)N1CCC(Oc2nncc3ccccc23)CC1 |
| InChI | InChI=1S/C22H20N4O3S/c27-30(28,20-9-3-6-16-7-4-12-23-21(16)20)26-13-10-18(11-14-26)29-22-19-8-2-1-5-17(19)15-24-25-22/h1-9,12,15,18H,10-11,13-14H2 |
| InChIKey | FPDHZYGKQQIRIM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 85.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |