C22H27F3N2O3S — CID 3548702
1-[(4-tert-butylphenyl)methyl]-4-[2-(trifluoromethoxy)phenyl]sulfonylpiperazine (PubChem CID 3548702) has the molecular formula C22H27F3N2O3S and a molecular weight of 456.53 g/mol. Its IUPAC name is 1-[(4-tert-butylphenyl)methyl]-4-[2-(trifluoromethoxy)phenyl]sulfonylpiperazine.
| Compound Name | 1-[(4-tert-butylphenyl)methyl]-4-[2-(trifluoromethoxy)phenyl]sulfonylpiperazine |
|---|---|
| PubChem CID | 3548702 |
| Molecular Formula | C22H27F3N2O3S |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 1-[(4-tert-butylphenyl)methyl]-4-[2-(trifluoromethoxy)phenyl]sulfonylpiperazine |
| SMILES | CC(C)(C)c1ccc(CN2CCN(S(=O)(=O)c3ccccc3OC(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C22H27F3N2O3S/c1-21(2,3)18-10-8-17(9-11-18)16-26-12-14-27(15-13-26)31(28,29)20-7-5-4-6-19(20)30-22(23,24)25/h4-11H,12-16H2,1-3H3 |
| InChIKey | DTSYSEDYFXIHKR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |