C20H22F3N3O4S — CID 3820684
N-methyl-N-phenyl-2-[4-[2-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]acetamide (PubChem CID 3820684) has the molecular formula C20H22F3N3O4S and a molecular weight of 457.47 g/mol. Its IUPAC name is N-methyl-N-phenyl-2-[4-[2-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]acetamide.
| Compound Name | N-methyl-N-phenyl-2-[4-[2-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 3820684 |
| Molecular Formula | C20H22F3N3O4S |
| Molecular Weight | 457.47 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | N-methyl-N-phenyl-2-[4-[2-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]acetamide |
| SMILES | CN(C(=O)CN1CCN(S(=O)(=O)c2ccccc2OC(F)(F)F)CC1)c1ccccc1 |
| InChI | InChI=1S/C20H22F3N3O4S/c1-24(16-7-3-2-4-8-16)19(27)15-25-11-13-26(14-12-25)31(28,29)18-10-6-5-9-17(18)30-20(21,22)23/h2-10H,11-15H2,1H3 |
| InChIKey | NTKDEHLKTZJSAD-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.47 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |