C25H25F3N2O3S — CID 92772886
1-[(S)-(4-methylphenyl)-phenylmethyl]-4-[2-(trifluoromethoxy)phenyl]sulfonylpiperazine (PubChem CID 92772886) has the molecular formula C25H25F3N2O3S and a molecular weight of 490.55 g/mol. Its IUPAC name is 1-[(S)-(4-methylphenyl)-phenylmethyl]-4-[2-(trifluoromethoxy)phenyl]sulfonylpiperazine.
| Compound Name | 1-[(S)-(4-methylphenyl)-phenylmethyl]-4-[2-(trifluoromethoxy)phenyl]sulfonylpiperazine |
|---|---|
| PubChem CID | 92772886 |
| Molecular Formula | C25H25F3N2O3S |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | 1-[(S)-(4-methylphenyl)-phenylmethyl]-4-[2-(trifluoromethoxy)phenyl]sulfonylpiperazine |
| SMILES | Cc1ccc(C(c2ccccc2)N2CCN(S(=O)(=O)c3ccccc3OC(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C25H25F3N2O3S/c1-19-11-13-21(14-12-19)24(20-7-3-2-4-8-20)29-15-17-30(18-16-29)34(31,32)23-10-6-5-9-22(23)33-25(26,27)28/h2-14,24H,15-18H2,1H3 |
| InChIKey | BCBNDZJMIJAMJS-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |