C24H24Cl2N2O2S — CID 92772321
1-(3-chloro-2-methylphenyl)sulfonyl-4-[(S)-(4-chlorophenyl)-phenylmethyl]piperazine (PubChem CID 92772321) has the molecular formula C24H24Cl2N2O2S and a molecular weight of 475.44 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)sulfonyl-4-[(S)-(4-chlorophenyl)-phenylmethyl]piperazine.
| Compound Name | 1-(3-chloro-2-methylphenyl)sulfonyl-4-[(S)-(4-chlorophenyl)-phenylmethyl]piperazine |
|---|---|
| PubChem CID | 92772321 |
| Molecular Formula | C24H24Cl2N2O2S |
| Molecular Weight | 475.44 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)sulfonyl-4-[(S)-(4-chlorophenyl)-phenylmethyl]piperazine |
| SMILES | Cc1c(Cl)cccc1S(=O)(=O)N1CCN(C(c2ccccc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C24H24Cl2N2O2S/c1-18-22(26)8-5-9-23(18)31(29,30)28-16-14-27(15-17-28)24(19-6-3-2-4-7-19)20-10-12-21(25)13-11-20/h2-13,24H,14-17H2,1H3 |
| InChIKey | NJSLEDBIFGITEF-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.44 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |