C24H24Cl2N2O3S — CID 6737163
1-[bis(4-chlorophenyl)methyl]-4-(4-methoxyphenyl)sulfonylpiperazine (PubChem CID 6737163) has the molecular formula C24H24Cl2N2O3S and a molecular weight of 491.44 g/mol. Its IUPAC name is 1-[bis(4-chlorophenyl)methyl]-4-(4-methoxyphenyl)sulfonylpiperazine.
| Compound Name | 1-[bis(4-chlorophenyl)methyl]-4-(4-methoxyphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 6737163 |
| Molecular Formula | C24H24Cl2N2O3S |
| Molecular Weight | 491.44 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | 1-[bis(4-chlorophenyl)methyl]-4-(4-methoxyphenyl)sulfonylpiperazine |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(C(c3ccc(Cl)cc3)c3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C24H24Cl2N2O3S/c1-31-22-10-12-23(13-11-22)32(29,30)28-16-14-27(15-17-28)24(18-2-6-20(25)7-3-18)19-4-8-21(26)9-5-19/h2-13,24H,14-17H2,1H3 |
| InChIKey | FYBGJYBMKIJCIO-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.44 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |