C20H25ClN2 — CID 118119340
1-[(S)-(4-chlorophenyl)-phenylmethyl]-4-propan-2-ylpiperazine (PubChem CID 118119340) has the molecular formula C20H25ClN2 and a molecular weight of 328.89 g/mol. Its IUPAC name is 1-[(S)-(4-chlorophenyl)-phenylmethyl]-4-propan-2-ylpiperazine.
| Compound Name | 1-[(S)-(4-chlorophenyl)-phenylmethyl]-4-propan-2-ylpiperazine |
|---|---|
| PubChem CID | 118119340 |
| Molecular Formula | C20H25ClN2 |
| Molecular Weight | 328.89 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 1-[(S)-(4-chlorophenyl)-phenylmethyl]-4-propan-2-ylpiperazine |
| SMILES | CC(C)N1CCN([C@@H](c2ccccc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H25ClN2/c1-16(2)22-12-14-23(15-13-22)20(17-6-4-3-5-7-17)18-8-10-19(21)11-9-18/h3-11,16,20H,12-15H2,1-2H3/t20-/m0/s1 |
| InChIKey | RTXXCQYHAHFPSO-FQEVSTJZSA-N |
| XLogP | 4.46 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.89 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |