C18H22Cl4N2 — CID 3065514
1-[bis(4-chlorophenyl)methyl]-4-methylpiperazine;dihydrochloride (PubChem CID 3065514) has the molecular formula C18H22Cl4N2 and a molecular weight of 408.20 g/mol. Its IUPAC name is 1-[bis(4-chlorophenyl)methyl]-4-methylpiperazine;dihydrochloride.
| Compound Name | 1-[bis(4-chlorophenyl)methyl]-4-methylpiperazine;dihydrochloride |
|---|---|
| PubChem CID | 3065514 |
| Molecular Formula | C18H22Cl4N2 |
| Molecular Weight | 408.20 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | 1-[bis(4-chlorophenyl)methyl]-4-methylpiperazine;dihydrochloride |
| SMILES | CN1CCN(C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)CC1.Cl.Cl |
| InChI | InChI=1S/C18H20Cl2N2.2ClH/c1-21-10-12-22(13-11-21)18(14-2-6-16(19)7-3-14)15-4-8-17(20)9-5-15;;/h2-9,18H,10-13H2,1H3;2*1H |
| InChIKey | AYSKQNXSAOXFLF-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.20 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |