C19H23ClN2 — CID 5393145
1-[(S)-(4-chlorophenyl)-phenylmethyl]-4-methyl-1,4-diazepane (PubChem CID 5393145) has the molecular formula C19H23ClN2 and a molecular weight of 314.86 g/mol. Its IUPAC name is 1-[(S)-(4-chlorophenyl)-phenylmethyl]-4-methyl-1,4-diazepane.
| Compound Name | 1-[(S)-(4-chlorophenyl)-phenylmethyl]-4-methyl-1,4-diazepane |
|---|---|
| PubChem CID | 5393145 |
| Molecular Formula | C19H23ClN2 |
| Molecular Weight | 314.86 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 1-[(S)-(4-chlorophenyl)-phenylmethyl]-4-methyl-1,4-diazepane |
| SMILES | CN1CCCN([C@@H](c2ccccc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C19H23ClN2/c1-21-12-5-13-22(15-14-21)19(16-6-3-2-4-7-16)17-8-10-18(20)11-9-17/h2-4,6-11,19H,5,12-15H2,1H3/t19-/m0/s1 |
| InChIKey | WEUCDJCFJHYFRL-IBGZPJMESA-N |
| XLogP | 4.07 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.86 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |