C22H26N4 — CID 11175409
1-methyl-4-[phenyl-[4-(1H-pyrazol-4-yl)phenyl]methyl]-1,4-diazepane (PubChem CID 11175409) has the molecular formula C22H26N4 and a molecular weight of 346.48 g/mol. Its IUPAC name is 1-methyl-4-[phenyl-[4-(1H-pyrazol-4-yl)phenyl]methyl]-1,4-diazepane.
| Compound Name | 1-methyl-4-[phenyl-[4-(1H-pyrazol-4-yl)phenyl]methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 11175409 |
| Molecular Formula | C22H26N4 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | 1-methyl-4-[phenyl-[4-(1H-pyrazol-4-yl)phenyl]methyl]-1,4-diazepane |
| SMILES | CN1CCCN(C(c2ccccc2)c2ccc(-c3cn[nH]c3)cc2)CC1 |
| InChI | InChI=1S/C22H26N4/c1-25-12-5-13-26(15-14-25)22(19-6-3-2-4-7-19)20-10-8-18(9-11-20)21-16-23-24-17-21/h2-4,6-11,16-17,22H,5,12-15H2,1H3,(H,23,24) |
| InChIKey | PVGMKLLGQDLGRJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |