About methanamine;4-phenyl-1H-pyrazole
methanamine;4-phenyl-1H-pyrazole (PubChem CID 174608925) has the molecular formula C12H23N5
and a molecular weight of 237.35 g/mol. Its IUPAC name is methanamine;4-phenyl-1H-pyrazole.
Molecular Properties
| Compound Name | methanamine;4-phenyl-1H-pyrazole |
| PubChem CID | 174608925 |
| Molecular Formula | C12H23N5 |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.20 |
| IUPAC Name | methanamine;4-phenyl-1H-pyrazole |
| SMILES | CN.CN.CN.c1ccc(-c2cn[nH]c2)cc1 |
| InChI | InChI=1S/C9H8N2.3CH5N/c1-2-4-8(5-3-1)9-6-10-11-7-9;3*1-2/h1-7H,(H,10,11);3*2H2,1H3 |
| InChIKey | JIZOBLPFBXJTLG-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methanamine;4-phenyl-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;4-phenyl-1H-pyrazole?
The IUPAC name of methanamine;4-phenyl-1H-pyrazole (CID 174608925) is methanamine;4-phenyl-1H-pyrazole.
What is the SMILES notation for methanamine;4-phenyl-1H-pyrazole?
The canonical SMILES for methanamine;4-phenyl-1H-pyrazole is CN.CN.CN.c1ccc(-c2cn[nH]c2)cc1.
What is the InChIKey of methanamine;4-phenyl-1H-pyrazole?
The InChIKey is JIZOBLPFBXJTLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2.3CH5N/c1-2-4-8(5-3-1)9-6-10-11-7-9;3*1-2/h1-7H,(H,10,11);3*2H2,1H3.
What are the key properties of methanamine;4-phenyl-1H-pyrazole?
methanamine;4-phenyl-1H-pyrazole has a molecular weight of 237.35 g/mol, XLogP of 0.80, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;4-phenyl-1H-pyrazole is sourced from PubChem (CID 174608925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).