C20H21ClN2O — CID 13048632
1-[1-benzofuran-2-yl-(4-chlorophenyl)methyl]-4-methylpiperazine (PubChem CID 13048632) has the molecular formula C20H21ClN2O and a molecular weight of 340.85 g/mol. Its IUPAC name is 1-[1-benzofuran-2-yl-(4-chlorophenyl)methyl]-4-methylpiperazine.
| Compound Name | 1-[1-benzofuran-2-yl-(4-chlorophenyl)methyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 13048632 |
| Molecular Formula | C20H21ClN2O |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 1-[1-benzofuran-2-yl-(4-chlorophenyl)methyl]-4-methylpiperazine |
| SMILES | CN1CCN(C(c2ccc(Cl)cc2)c2cc3ccccc3o2)CC1 |
| InChI | InChI=1S/C20H21ClN2O/c1-22-10-12-23(13-11-22)20(15-6-8-17(21)9-7-15)19-14-16-4-2-3-5-18(16)24-19/h2-9,14,20H,10-13H2,1H3 |
| InChIKey | BLEIHYQZEAXAMR-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 19.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |