C18H17NO2 — CID 114723692
1-benzofuran-2-yl-(1-methyl-2,3-dihydroindol-5-yl)methanol (PubChem CID 114723692) has the molecular formula C18H17NO2 and a molecular weight of 279.34 g/mol. Its IUPAC name is 1-benzofuran-2-yl-(1-methyl-2,3-dihydroindol-5-yl)methanol.
| Compound Name | 1-benzofuran-2-yl-(1-methyl-2,3-dihydroindol-5-yl)methanol |
|---|---|
| PubChem CID | 114723692 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 1-benzofuran-2-yl-(1-methyl-2,3-dihydroindol-5-yl)methanol |
| SMILES | CN1CCc2cc(C(O)c3cc4ccccc4o3)ccc21 |
| InChI | InChI=1S/C18H17NO2/c1-19-9-8-12-10-14(6-7-15(12)19)18(20)17-11-13-4-2-3-5-16(13)21-17/h2-7,10-11,18,20H,8-9H2,1H3 |
| InChIKey | GUMUGHSDUQYGNH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 36.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|