C15H10F2O2 — CID 63089375
1-benzofuran-2-yl-(3,4-difluorophenyl)methanol (PubChem CID 63089375) has the molecular formula C15H10F2O2 and a molecular weight of 260.24 g/mol. Its IUPAC name is 1-benzofuran-2-yl-(3,4-difluorophenyl)methanol.
| Compound Name | 1-benzofuran-2-yl-(3,4-difluorophenyl)methanol |
|---|---|
| PubChem CID | 63089375 |
| Molecular Formula | C15H10F2O2 |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 1-benzofuran-2-yl-(3,4-difluorophenyl)methanol |
| SMILES | OC(c1ccc(F)c(F)c1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C15H10F2O2/c16-11-6-5-10(7-12(11)17)15(18)14-8-9-3-1-2-4-13(9)19-14/h1-8,15,18H |
| InChIKey | CHYYOBGNRLUIMI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |