C15H9BrF2O2 — CID 115836064
1-benzofuran-2-yl-(4-bromo-2,6-difluorophenyl)methanol (PubChem CID 115836064) has the molecular formula C15H9BrF2O2 and a molecular weight of 339.14 g/mol. Its IUPAC name is 1-benzofuran-2-yl-(4-bromo-2,6-difluorophenyl)methanol.
| Compound Name | 1-benzofuran-2-yl-(4-bromo-2,6-difluorophenyl)methanol |
|---|---|
| PubChem CID | 115836064 |
| Molecular Formula | C15H9BrF2O2 |
| Molecular Weight | 339.14 g/mol |
| Exact Mass | 337.98 |
| IUPAC Name | 1-benzofuran-2-yl-(4-bromo-2,6-difluorophenyl)methanol |
| SMILES | OC(c1cc2ccccc2o1)c1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C15H9BrF2O2/c16-9-6-10(17)14(11(18)7-9)15(19)13-5-8-3-1-2-4-12(8)20-13/h1-7,15,19H |
| InChIKey | NMHROHHENASWIL-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.14 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |