C15H8F4O2 — CID 115836932
(7-fluoro-1-benzofuran-2-yl)-(2,4,6-trifluorophenyl)methanol (PubChem CID 115836932) has the molecular formula C15H8F4O2 and a molecular weight of 296.22 g/mol. Its IUPAC name is (7-fluoro-1-benzofuran-2-yl)-(2,4,6-trifluorophenyl)methanol.
| Compound Name | (7-fluoro-1-benzofuran-2-yl)-(2,4,6-trifluorophenyl)methanol |
|---|---|
| PubChem CID | 115836932 |
| Molecular Formula | C15H8F4O2 |
| Molecular Weight | 296.22 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | (7-fluoro-1-benzofuran-2-yl)-(2,4,6-trifluorophenyl)methanol |
| SMILES | OC(c1cc2cccc(F)c2o1)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C15H8F4O2/c16-8-5-10(18)13(11(19)6-8)14(20)12-4-7-2-1-3-9(17)15(7)21-12/h1-6,14,20H |
| InChIKey | QOLUGYOAYOGBHU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.22 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |