C15H9Br2FO2 — CID 107947837
(2,4-dibromophenyl)-(7-fluoro-1-benzofuran-2-yl)methanol (PubChem CID 107947837) has the molecular formula C15H9Br2FO2 and a molecular weight of 400.04 g/mol. Its IUPAC name is (2,4-dibromophenyl)-(7-fluoro-1-benzofuran-2-yl)methanol.
| Compound Name | (2,4-dibromophenyl)-(7-fluoro-1-benzofuran-2-yl)methanol |
|---|---|
| PubChem CID | 107947837 |
| Molecular Formula | C15H9Br2FO2 |
| Molecular Weight | 400.04 g/mol |
| Exact Mass | 397.90 |
| IUPAC Name | (2,4-dibromophenyl)-(7-fluoro-1-benzofuran-2-yl)methanol |
| SMILES | OC(c1cc2cccc(F)c2o1)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C15H9Br2FO2/c16-9-4-5-10(11(17)7-9)14(19)13-6-8-2-1-3-12(18)15(8)20-13/h1-7,14,19H |
| InChIKey | IUKOIBFHCMRKCL-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.04 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |