C15H10BrF2NO — CID 105044197
1-benzofuran-2-yl-(4-bromo-2,6-difluorophenyl)methanamine (PubChem CID 105044197) has the molecular formula C15H10BrF2NO and a molecular weight of 338.15 g/mol. Its IUPAC name is 1-benzofuran-2-yl-(4-bromo-2,6-difluorophenyl)methanamine.
| Compound Name | 1-benzofuran-2-yl-(4-bromo-2,6-difluorophenyl)methanamine |
|---|---|
| PubChem CID | 105044197 |
| Molecular Formula | C15H10BrF2NO |
| Molecular Weight | 338.15 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | 1-benzofuran-2-yl-(4-bromo-2,6-difluorophenyl)methanamine |
| SMILES | NC(c1cc2ccccc2o1)c1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C15H10BrF2NO/c16-9-6-10(17)14(11(18)7-9)15(19)13-5-8-3-1-2-4-12(8)20-13/h1-7,15H,19H2 |
| InChIKey | DLHBLLMBKZHQBA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.15 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |