C16H13F2NO — CID 105043942
1-benzofuran-2-yl-(2,4-difluoro-5-methylphenyl)methanamine (PubChem CID 105043942) has the molecular formula C16H13F2NO and a molecular weight of 273.28 g/mol. Its IUPAC name is 1-benzofuran-2-yl-(2,4-difluoro-5-methylphenyl)methanamine.
| Compound Name | 1-benzofuran-2-yl-(2,4-difluoro-5-methylphenyl)methanamine |
|---|---|
| PubChem CID | 105043942 |
| Molecular Formula | C16H13F2NO |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 1-benzofuran-2-yl-(2,4-difluoro-5-methylphenyl)methanamine |
| SMILES | Cc1cc(C(N)c2cc3ccccc3o2)c(F)cc1F |
| InChI | InChI=1S/C16H13F2NO/c1-9-6-11(13(18)8-12(9)17)16(19)15-7-10-4-2-3-5-14(10)20-15/h2-8,16H,19H2,1H3 |
| InChIKey | PUKUPWIJGXVPLH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |