C12H10ClF2NO — CID 106684492
(5-chlorofuran-2-yl)-(2,4-difluoro-5-methylphenyl)methanamine (PubChem CID 106684492) has the molecular formula C12H10ClF2NO and a molecular weight of 257.67 g/mol. Its IUPAC name is (5-chlorofuran-2-yl)-(2,4-difluoro-5-methylphenyl)methanamine.
| Compound Name | (5-chlorofuran-2-yl)-(2,4-difluoro-5-methylphenyl)methanamine |
|---|---|
| PubChem CID | 106684492 |
| Molecular Formula | C12H10ClF2NO |
| Molecular Weight | 257.67 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | (5-chlorofuran-2-yl)-(2,4-difluoro-5-methylphenyl)methanamine |
| SMILES | Cc1cc(C(N)c2ccc(Cl)o2)c(F)cc1F |
| InChI | InChI=1S/C12H10ClF2NO/c1-6-4-7(9(15)5-8(6)14)12(16)10-2-3-11(13)17-10/h2-5,12H,16H2,1H3 |
| InChIKey | IQPYHMNBOCGQBT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.67 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |