C11H8ClF2NO — CID 106691928
(5-chlorofuran-2-yl)-(3,5-difluorophenyl)methanamine (PubChem CID 106691928) has the molecular formula C11H8ClF2NO and a molecular weight of 243.64 g/mol. Its IUPAC name is (5-chlorofuran-2-yl)-(3,5-difluorophenyl)methanamine.
| Compound Name | (5-chlorofuran-2-yl)-(3,5-difluorophenyl)methanamine |
|---|---|
| PubChem CID | 106691928 |
| Molecular Formula | C11H8ClF2NO |
| Molecular Weight | 243.64 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | (5-chlorofuran-2-yl)-(3,5-difluorophenyl)methanamine |
| SMILES | NC(c1cc(F)cc(F)c1)c1ccc(Cl)o1 |
| InChI | InChI=1S/C11H8ClF2NO/c12-10-2-1-9(16-10)11(15)6-3-7(13)5-8(14)4-6/h1-5,11H,15H2 |
| InChIKey | JXDVSVXBCXPUMQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.64 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |