C13H12ClF2NO2 — CID 106690427
3-amino-1-(5-chlorofuran-2-yl)-2-(3,5-difluorophenyl)propan-1-ol (PubChem CID 106690427) has the molecular formula C13H12ClF2NO2 and a molecular weight of 287.69 g/mol. Its IUPAC name is 3-amino-1-(5-chlorofuran-2-yl)-2-(3,5-difluorophenyl)propan-1-ol.
| Compound Name | 3-amino-1-(5-chlorofuran-2-yl)-2-(3,5-difluorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 106690427 |
| Molecular Formula | C13H12ClF2NO2 |
| Molecular Weight | 287.69 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 3-amino-1-(5-chlorofuran-2-yl)-2-(3,5-difluorophenyl)propan-1-ol |
| SMILES | NCC(c1cc(F)cc(F)c1)C(O)c1ccc(Cl)o1 |
| InChI | InChI=1S/C13H12ClF2NO2/c14-12-2-1-11(19-12)13(18)10(6-17)7-3-8(15)5-9(16)4-7/h1-5,10,13,18H,6,17H2 |
| InChIKey | KSUVNQMIHXJGBF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.69 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |