C14H16FNO2 — CID 65190027
3-amino-2-(3-fluorophenyl)-1-(5-methylfuran-2-yl)propan-1-ol (PubChem CID 65190027) has the molecular formula C14H16FNO2 and a molecular weight of 249.29 g/mol. Its IUPAC name is 3-amino-2-(3-fluorophenyl)-1-(5-methylfuran-2-yl)propan-1-ol.
| Compound Name | 3-amino-2-(3-fluorophenyl)-1-(5-methylfuran-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 65190027 |
| Molecular Formula | C14H16FNO2 |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 3-amino-2-(3-fluorophenyl)-1-(5-methylfuran-2-yl)propan-1-ol |
| SMILES | Cc1ccc(C(O)C(CN)c2cccc(F)c2)o1 |
| InChI | InChI=1S/C14H16FNO2/c1-9-5-6-13(18-9)14(17)12(8-16)10-3-2-4-11(15)7-10/h2-7,12,14,17H,8,16H2,1H3 |
| InChIKey | RTTBMCBAUCDZOF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |