C15H13Cl2F2NO — CID 65189329
3-amino-1-(2,4-dichlorophenyl)-2-(3,5-difluorophenyl)propan-1-ol (PubChem CID 65189329) has the molecular formula C15H13Cl2F2NO and a molecular weight of 332.18 g/mol. Its IUPAC name is 3-amino-1-(2,4-dichlorophenyl)-2-(3,5-difluorophenyl)propan-1-ol.
| Compound Name | 3-amino-1-(2,4-dichlorophenyl)-2-(3,5-difluorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 65189329 |
| Molecular Formula | C15H13Cl2F2NO |
| Molecular Weight | 332.18 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 3-amino-1-(2,4-dichlorophenyl)-2-(3,5-difluorophenyl)propan-1-ol |
| SMILES | NCC(c1cc(F)cc(F)c1)C(O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H13Cl2F2NO/c16-9-1-2-12(14(17)5-9)15(21)13(7-20)8-3-10(18)6-11(19)4-8/h1-6,13,15,21H,7,20H2 |
| InChIKey | RMSZXPQXGWWYIR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.18 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |