C15H14Cl3NO — CID 65186212
3-amino-2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)propan-1-ol (PubChem CID 65186212) has the molecular formula C15H14Cl3NO and a molecular weight of 330.64 g/mol. Its IUPAC name is 3-amino-2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)propan-1-ol.
| Compound Name | 3-amino-2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 65186212 |
| Molecular Formula | C15H14Cl3NO |
| Molecular Weight | 330.64 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | 3-amino-2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)propan-1-ol |
| SMILES | NCC(c1ccc(Cl)cc1)C(O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H14Cl3NO/c16-10-3-1-9(2-4-10)13(8-19)15(20)12-6-5-11(17)7-14(12)18/h1-7,13,15,20H,8,19H2 |
| InChIKey | LWFKABCWZPVBDX-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.64 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |