C18H19NO2 — CID 103433505
1-benzofuran-2-yl-(2-methoxy-3,4-dimethylphenyl)methanamine (PubChem CID 103433505) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 1-benzofuran-2-yl-(2-methoxy-3,4-dimethylphenyl)methanamine.
| Compound Name | 1-benzofuran-2-yl-(2-methoxy-3,4-dimethylphenyl)methanamine |
|---|---|
| PubChem CID | 103433505 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 1-benzofuran-2-yl-(2-methoxy-3,4-dimethylphenyl)methanamine |
| SMILES | COc1c(C(N)c2cc3ccccc3o2)ccc(C)c1C |
| InChI | InChI=1S/C18H19NO2/c1-11-8-9-14(18(20-3)12(11)2)17(19)16-10-13-6-4-5-7-15(13)21-16/h4-10,17H,19H2,1-3H3 |
| InChIKey | KTRMGCPJGXTSNH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |