C18H19NO — CID 60727883
1-benzofuran-2-yl-(2,4,5-trimethylphenyl)methanamine (PubChem CID 60727883) has the molecular formula C18H19NO and a molecular weight of 265.36 g/mol. Its IUPAC name is 1-benzofuran-2-yl-(2,4,5-trimethylphenyl)methanamine.
| Compound Name | 1-benzofuran-2-yl-(2,4,5-trimethylphenyl)methanamine |
|---|---|
| PubChem CID | 60727883 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 1-benzofuran-2-yl-(2,4,5-trimethylphenyl)methanamine |
| SMILES | Cc1cc(C)c(C(N)c2cc3ccccc3o2)cc1C |
| InChI | InChI=1S/C18H19NO/c1-11-8-13(3)15(9-12(11)2)18(19)17-10-14-6-4-5-7-16(14)20-17/h4-10,18H,19H2,1-3H3 |
| InChIKey | FDEJZVQQTYVCNC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |