C15H10F3NO — CID 114728145
1-benzofuran-2-yl-(3,4,5-trifluorophenyl)methanamine (PubChem CID 114728145) has the molecular formula C15H10F3NO and a molecular weight of 277.25 g/mol. Its IUPAC name is 1-benzofuran-2-yl-(3,4,5-trifluorophenyl)methanamine.
| Compound Name | 1-benzofuran-2-yl-(3,4,5-trifluorophenyl)methanamine |
|---|---|
| PubChem CID | 114728145 |
| Molecular Formula | C15H10F3NO |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 1-benzofuran-2-yl-(3,4,5-trifluorophenyl)methanamine |
| SMILES | NC(c1cc(F)c(F)c(F)c1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C15H10F3NO/c16-10-5-9(6-11(17)14(10)18)15(19)13-7-8-3-1-2-4-12(8)20-13/h1-7,15H,19H2 |
| InChIKey | RRRWLIYODCGEGW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|