C14H15NO2 — CID 63948147
furan-3-yl-(1-methyl-2,3-dihydroindol-5-yl)methanol (PubChem CID 63948147) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is furan-3-yl-(1-methyl-2,3-dihydroindol-5-yl)methanol.
| Compound Name | furan-3-yl-(1-methyl-2,3-dihydroindol-5-yl)methanol |
|---|---|
| PubChem CID | 63948147 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | furan-3-yl-(1-methyl-2,3-dihydroindol-5-yl)methanol |
| SMILES | CN1CCc2cc(C(O)c3ccoc3)ccc21 |
| InChI | InChI=1S/C14H15NO2/c1-15-6-4-10-8-11(2-3-13(10)15)14(16)12-5-7-17-9-12/h2-3,5,7-9,14,16H,4,6H2,1H3 |
| InChIKey | UTSZRTWKNDZXFI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 36.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|