C17H17F2NO — CID 82802452
(2,6-difluoro-3-methylphenyl)-(1-methyl-2,3-dihydroindol-5-yl)methanol (PubChem CID 82802452) has the molecular formula C17H17F2NO and a molecular weight of 289.33 g/mol. Its IUPAC name is (2,6-difluoro-3-methylphenyl)-(1-methyl-2,3-dihydroindol-5-yl)methanol.
| Compound Name | (2,6-difluoro-3-methylphenyl)-(1-methyl-2,3-dihydroindol-5-yl)methanol |
|---|---|
| PubChem CID | 82802452 |
| Molecular Formula | C17H17F2NO |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | (2,6-difluoro-3-methylphenyl)-(1-methyl-2,3-dihydroindol-5-yl)methanol |
| SMILES | Cc1ccc(F)c(C(O)c2ccc3c(c2)CCN3C)c1F |
| InChI | InChI=1S/C17H17F2NO/c1-10-3-5-13(18)15(16(10)19)17(21)12-4-6-14-11(9-12)7-8-20(14)2/h3-6,9,17,21H,7-8H2,1-2H3 |
| InChIKey | KJELNLAJLDAKHR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|