C17H23NO — CID 106651079
cyclohepten-1-yl-(1-methyl-2,3-dihydroindol-5-yl)methanol (PubChem CID 106651079) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is cyclohepten-1-yl-(1-methyl-2,3-dihydroindol-5-yl)methanol.
| Compound Name | cyclohepten-1-yl-(1-methyl-2,3-dihydroindol-5-yl)methanol |
|---|---|
| PubChem CID | 106651079 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | cyclohepten-1-yl-(1-methyl-2,3-dihydroindol-5-yl)methanol |
| SMILES | CN1CCc2cc(C(O)C3=CCCCCC3)ccc21 |
| InChI | InChI=1S/C17H23NO/c1-18-11-10-14-12-15(8-9-16(14)18)17(19)13-6-4-2-3-5-7-13/h6,8-9,12,17,19H,2-5,7,10-11H2,1H3 |
| InChIKey | KCWWOHJLYBCCTF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|