C15H17NOS — CID 102829226
(1-methyl-2,3-dihydroindol-5-yl)-(2-methylthiophen-3-yl)methanol (PubChem CID 102829226) has the molecular formula C15H17NOS and a molecular weight of 259.37 g/mol. Its IUPAC name is (1-methyl-2,3-dihydroindol-5-yl)-(2-methylthiophen-3-yl)methanol.
| Compound Name | (1-methyl-2,3-dihydroindol-5-yl)-(2-methylthiophen-3-yl)methanol |
|---|---|
| PubChem CID | 102829226 |
| Molecular Formula | C15H17NOS |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | (1-methyl-2,3-dihydroindol-5-yl)-(2-methylthiophen-3-yl)methanol |
| SMILES | Cc1sccc1C(O)c1ccc2c(c1)CCN2C |
| InChI | InChI=1S/C15H17NOS/c1-10-13(6-8-18-10)15(17)12-3-4-14-11(9-12)5-7-16(14)2/h3-4,6,8-9,15,17H,5,7H2,1-2H3 |
| InChIKey | QRJLPEWKONFVLH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|