C16H15Cl2NO — CID 63900549
(2,5-dichlorophenyl)-(1-methyl-2,3-dihydroindol-5-yl)methanol (PubChem CID 63900549) has the molecular formula C16H15Cl2NO and a molecular weight of 308.21 g/mol. Its IUPAC name is (2,5-dichlorophenyl)-(1-methyl-2,3-dihydroindol-5-yl)methanol.
| Compound Name | (2,5-dichlorophenyl)-(1-methyl-2,3-dihydroindol-5-yl)methanol |
|---|---|
| PubChem CID | 63900549 |
| Molecular Formula | C16H15Cl2NO |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | (2,5-dichlorophenyl)-(1-methyl-2,3-dihydroindol-5-yl)methanol |
| SMILES | CN1CCc2cc(C(O)c3cc(Cl)ccc3Cl)ccc21 |
| InChI | InChI=1S/C16H15Cl2NO/c1-19-7-6-10-8-11(2-5-15(10)19)16(20)13-9-12(17)3-4-14(13)18/h2-5,8-9,16,20H,6-7H2,1H3 |
| InChIKey | LCKSXACLQUJXOH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|