C14H11F3O — CID 82815798
(2,6-difluoro-3-methylphenyl)-(4-fluorophenyl)methanol (PubChem CID 82815798) has the molecular formula C14H11F3O and a molecular weight of 252.23 g/mol. Its IUPAC name is (2,6-difluoro-3-methylphenyl)-(4-fluorophenyl)methanol.
| Compound Name | (2,6-difluoro-3-methylphenyl)-(4-fluorophenyl)methanol |
|---|---|
| PubChem CID | 82815798 |
| Molecular Formula | C14H11F3O |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | (2,6-difluoro-3-methylphenyl)-(4-fluorophenyl)methanol |
| SMILES | Cc1ccc(F)c(C(O)c2ccc(F)cc2)c1F |
| InChI | InChI=1S/C14H11F3O/c1-8-2-7-11(16)12(13(8)17)14(18)9-3-5-10(15)6-4-9/h2-7,14,18H,1H3 |
| InChIKey | JHLCTRJOHZHYEF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |