C25H29Cl3N2 — CID 171382098
1-[(4-chlorophenyl)-phenylmethyl]-4-[(4-methylphenyl)methyl]piperazine;dihydrochloride (PubChem CID 171382098) has the molecular formula C25H29Cl3N2 and a molecular weight of 463.88 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)-phenylmethyl]-4-[(4-methylphenyl)methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(4-chlorophenyl)-phenylmethyl]-4-[(4-methylphenyl)methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171382098 |
| Molecular Formula | C25H29Cl3N2 |
| Molecular Weight | 463.88 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | 1-[(4-chlorophenyl)-phenylmethyl]-4-[(4-methylphenyl)methyl]piperazine;dihydrochloride |
| SMILES | Cc1ccc(CN2CCN(C(c3ccccc3)c3ccc(Cl)cc3)CC2)cc1.Cl.Cl |
| InChI | InChI=1S/C25H27ClN2.2ClH/c1-20-7-9-21(10-8-20)19-27-15-17-28(18-16-27)25(22-5-3-2-4-6-22)23-11-13-24(26)14-12-23;;/h2-14,25H,15-19H2,1H3;2*1H |
| InChIKey | HYPDXQAGPYKWEO-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.88 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |