C32H41ClN2O — CID 2147371
4-[(S)-(4-benzylpiperazin-1-yl)-(4-chlorophenyl)methyl]-2,6-ditert-butylphenol (PubChem CID 2147371) has the molecular formula C32H41ClN2O and a molecular weight of 505.15 g/mol. Its IUPAC name is 4-[(S)-(4-benzylpiperazin-1-yl)-(4-chlorophenyl)methyl]-2,6-ditert-butylphenol.
| Compound Name | 4-[(S)-(4-benzylpiperazin-1-yl)-(4-chlorophenyl)methyl]-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 2147371 |
| Molecular Formula | C32H41ClN2O |
| Molecular Weight | 505.15 g/mol |
| Exact Mass | 504.29 |
| IUPAC Name | 4-[(S)-(4-benzylpiperazin-1-yl)-(4-chlorophenyl)methyl]-2,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc([C@H](c2ccc(Cl)cc2)N2CCN(Cc3ccccc3)CC2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C32H41ClN2O/c1-31(2,3)27-20-25(21-28(30(27)36)32(4,5)6)29(24-12-14-26(33)15-13-24)35-18-16-34(17-19-35)22-23-10-8-7-9-11-23/h7-15,20-21,29,36H,16-19,22H2,1-6H3/t29-/m0/s1 |
| InChIKey | RYXWVOIAHOWXOH-LJAQVGFWSA-N |
| XLogP | 7.55 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.15 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |